C23H20N6 — CID 89082807
4-[2-[[3-(4-aminophenyl)-1H-pyrazol-5-yl]methylamino]-4-pyridinyl]-3-methylbenzonitrile (PubChem CID 89082807) has the molecular formula C23H20N6 and a molecular weight of 380.46 g/mol. Its IUPAC name is 4-[2-[[3-(4-aminophenyl)-1H-pyrazol-5-yl]methylamino]-4-pyridinyl]-3-methylbenzonitrile.
| Compound Name | 4-[2-[[3-(4-aminophenyl)-1H-pyrazol-5-yl]methylamino]-4-pyridinyl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 89082807 |
| Molecular Formula | C23H20N6 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 4-[2-[[3-(4-aminophenyl)-1H-pyrazol-5-yl]methylamino]-4-pyridinyl]-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1-c1ccnc(NCc2cc(-c3ccc(N)cc3)n[nH]2)c1 |
| InChI | InChI=1S/C23H20N6/c1-15-10-16(13-24)2-7-21(15)18-8-9-26-23(11-18)27-14-20-12-22(29-28-20)17-3-5-19(25)6-4-17/h2-12H,14,25H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | IWLCLFJKTDLNMK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|