C44H33N5 — CID 89083759
N-(8-cyclohexa-1,3-dien-1-yl-5,6-diphenyl-6,7-dihydrotriphenylen-2-yl)-N-pyrazin-2-ylpyrazin-2-amine (PubChem CID 89083759) has the molecular formula C44H33N5 and a molecular weight of 631.78 g/mol. Its IUPAC name is N-(8-cyclohexa-1,3-dien-1-yl-5,6-diphenyl-6,7-dihydrotriphenylen-2-yl)-N-pyrazin-2-ylpyrazin-2-amine.
| Compound Name | N-(8-cyclohexa-1,3-dien-1-yl-5,6-diphenyl-6,7-dihydrotriphenylen-2-yl)-N-pyrazin-2-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 89083759 |
| Molecular Formula | C44H33N5 |
| Molecular Weight | 631.78 g/mol |
| Exact Mass | 631.27 |
| IUPAC Name | N-(8-cyclohexa-1,3-dien-1-yl-5,6-diphenyl-6,7-dihydrotriphenylen-2-yl)-N-pyrazin-2-ylpyrazin-2-amine |
| SMILES | C1=CCCC(C2=c3c(c4ccc(N(c5cnccn5)c5cnccn5)cc4c4ccccc34)=C(c3ccccc3)C(c3ccccc3)C2)=C1 |
| InChI | InChI=1S/C44H33N5/c1-4-12-30(13-5-1)37-27-38(31-14-6-2-7-15-31)43-35-19-11-10-18-34(35)39-26-33(20-21-36(39)44(43)42(37)32-16-8-3-9-17-32)49(40-28-45-22-24-47-40)41-29-46-23-25-48-41/h1-6,8-14,16-26,28-29,37H,7,15,27H2 |
| InChIKey | SBKPBRUGJRGZFK-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.78 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|