C37H31NO5S — CID 89085552
3,5-bis[(4-benzoylphenyl)methoxy]-N-(1-sulfanylethyl)benzamide (PubChem CID 89085552) has the molecular formula C37H31NO5S and a molecular weight of 601.72 g/mol. Its IUPAC name is 3,5-bis[(4-benzoylphenyl)methoxy]-N-(1-sulfanylethyl)benzamide.
| Compound Name | 3,5-bis[(4-benzoylphenyl)methoxy]-N-(1-sulfanylethyl)benzamide |
|---|---|
| PubChem CID | 89085552 |
| Molecular Formula | C37H31NO5S |
| Molecular Weight | 601.72 g/mol |
| Exact Mass | 601.19 |
| IUPAC Name | 3,5-bis[(4-benzoylphenyl)methoxy]-N-(1-sulfanylethyl)benzamide |
| SMILES | CC(S)NC(=O)c1cc(OCc2ccc(C(=O)c3ccccc3)cc2)cc(OCc2ccc(C(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C37H31NO5S/c1-25(44)38-37(41)32-20-33(42-23-26-12-16-30(17-13-26)35(39)28-8-4-2-5-9-28)22-34(21-32)43-24-27-14-18-31(19-15-27)36(40)29-10-6-3-7-11-29/h2-22,25,44H,23-24H2,1H3,(H,38,41) |
| InChIKey | HNDPGZOHWFDILB-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.72 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|