C7H11NO2 — CID 89087542
[(2R,3S)-3-methyl-5-methylidenepyrrolidin-2-yl] formate (PubChem CID 89087542) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is [(2R,3S)-3-methyl-5-methylidenepyrrolidin-2-yl] formate.
| Compound Name | [(2R,3S)-3-methyl-5-methylidenepyrrolidin-2-yl] formate |
|---|---|
| PubChem CID | 89087542 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | [(2R,3S)-3-methyl-5-methylidenepyrrolidin-2-yl] formate |
| SMILES | C=C1C[C@H](C)[C@@H](OC=O)N1 |
| InChI | InChI=1S/C7H11NO2/c1-5-3-6(2)8-7(5)10-4-9/h4-5,7-8H,2-3H2,1H3/t5-,7+/m0/s1 |
| InChIKey | LHMHLKGXBSNBEI-CAHLUQPWSA-N |
| XLogP | 0.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|