C41H27N3 — CID 89088917
8-[4-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-8-azatricyclo[7.4.1.02,7]tetradeca-1(14),2,4,6,9(14),10,12-heptaene (PubChem CID 89088917) has the molecular formula C41H27N3 and a molecular weight of 561.69 g/mol. Its IUPAC name is 8-[4-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-8-azatricyclo[7.4.1.02,7]tetradeca-1(14),2,4,6,9(14),10,12-heptaene.
| Compound Name | 8-[4-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-8-azatricyclo[7.4.1.02,7]tetradeca-1(14),2,4,6,9(14),10,12-heptaene |
|---|---|
| PubChem CID | 89088917 |
| Molecular Formula | C41H27N3 |
| Molecular Weight | 561.69 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | 8-[4-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]phenyl]-8-azatricyclo[7.4.1.02,7]tetradeca-1(14),2,4,6,9(14),10,12-heptaene |
| SMILES | C1=C2C=CC=CC=1N(c1ccc(-c3cccc(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)c3)cc1)c1ccccc12 |
| InChI | InChI=1S/C41H27N3/c1-3-12-30(13-4-1)38-28-39(31-14-5-2-6-15-31)43-41(42-38)34-18-11-17-32(26-34)29-22-24-35(25-23-29)44-36-19-8-7-16-33(27-36)37-20-9-10-21-40(37)44/h1-26,28H |
| InChIKey | UWEIPDIDUZNOTB-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.69 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |