C13H16BrNO2 — CID 89089726
N-[4-(4-bromo-3-hydroxyphenyl)pent-4-enyl]acetamide (PubChem CID 89089726) has the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. Its IUPAC name is N-[4-(4-bromo-3-hydroxyphenyl)pent-4-enyl]acetamide.
| Compound Name | N-[4-(4-bromo-3-hydroxyphenyl)pent-4-enyl]acetamide |
|---|---|
| PubChem CID | 89089726 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | N-[4-(4-bromo-3-hydroxyphenyl)pent-4-enyl]acetamide |
| SMILES | C=C(CCCNC(C)=O)c1ccc(Br)c(O)c1 |
| InChI | InChI=1S/C13H16BrNO2/c1-9(4-3-7-15-10(2)16)11-5-6-12(14)13(17)8-11/h5-6,8,17H,1,3-4,7H2,2H3,(H,15,16) |
| InChIKey | BTDVDPRKUHPIGH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|