(2R)-2-amino-4-propoxypentanoic acid

C8H17NO3 — CID 89091737

IUPAC(2R)-2-amino-4-propoxypentanoic acid
SMILESCCCOC(C)C[C@@H](N)C(=O)O
InChIInChI=1S/C8H17NO3/c1-3-4-12-6(2)5-7(9)8(10)11/h6-7H,3-5,9H2,1-2H3,(H,10,11)/t6?,7-/m1/s1
InChIKeyREYZENZBIWHNMI-COBSHVIPSA-N
MW175.23 g/mol
LogP0.60
Rot. Bonds6

About (2R)-2-amino-4-propoxypentanoic acid

(2R)-2-amino-4-propoxypentanoic acid (PubChem CID 89091737) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is (2R)-2-amino-4-propoxypentanoic acid.

Molecular Properties

Compound Name(2R)-2-amino-4-propoxypentanoic acid
PubChem CID89091737
Molecular FormulaC8H17NO3
Molecular Weight175.23 g/mol
Exact Mass175.12
IUPAC Name(2R)-2-amino-4-propoxypentanoic acid
SMILESCCCOC(C)C[C@@H](N)C(=O)O
InChIInChI=1S/C8H17NO3/c1-3-4-12-6(2)5-7(9)8(10)11/h6-7H,3-5,9H2,1-2H3,(H,10,11)/t6?,7-/m1/s1
InChIKeyREYZENZBIWHNMI-COBSHVIPSA-N
XLogP0.60
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500175.23
LogP ≤ 50.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2R)-2-amino-4-propoxypentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2S,4R)-2-amino-4-ethoxypentanoic acid
CID 87418096
2-amino-4-methoxypentanoic acid
CID 21255646
propyl 3-propoxybutanoate
CID 175273522
(2S)-2-(15N)azanyl-4-methyl(213C)pentanoic acid
CID 71309151
4-amino-2-methyl-5-oxo-5-propoxypentanoic acid
CID 154095903
acetic acid;1-methoxy-2-propoxypropane
CID 159297729
CID 6369563
CID 6369563
2-amino-4-methylpentanoic acid;chromium
CID 88640601
2-amino-4-hydroxypentanoic acid
CID 14021586
(2S)-2-amino-4-methylpentanoic acid;cerium
CID 86698944
(2S)-2-amino-4-methylpentanoic acid;hydrazine
CID 160824424
(2S)-2-amino-4-methylpentanoic acid;propanoic acid
CID 158078275

Frequently Asked Questions

What is the IUPAC name of (2R)-2-amino-4-propoxypentanoic acid?
The IUPAC name of (2R)-2-amino-4-propoxypentanoic acid (CID 89091737) is (2R)-2-amino-4-propoxypentanoic acid.
What is the SMILES notation for (2R)-2-amino-4-propoxypentanoic acid?
The canonical SMILES for (2R)-2-amino-4-propoxypentanoic acid is CCCOC(C)C[C@@H](N)C(=O)O.
What is the InChIKey of (2R)-2-amino-4-propoxypentanoic acid?
The InChIKey is REYZENZBIWHNMI-COBSHVIPSA-N. The full InChI is InChI=1S/C8H17NO3/c1-3-4-12-6(2)5-7(9)8(10)11/h6-7H,3-5,9H2,1-2H3,(H,10,11)/t6?,7-/m1/s1.
What are the key properties of (2R)-2-amino-4-propoxypentanoic acid?
(2R)-2-amino-4-propoxypentanoic acid has a molecular weight of 175.23 g/mol, XLogP of 0.60, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-4-propoxypentanoic acid is sourced from PubChem (CID 89091737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).