C34H48BN3O5 — CID 89092998
CID 89092998 (PubChem CID 89092998) has the molecular formula C34H48BN3O5 and a molecular weight of 589.59 g/mol.
| Compound Name | CID 89092998 |
|---|---|
| PubChem CID | 89092998 |
| Molecular Formula | C34H48BN3O5 |
| Molecular Weight | 589.59 g/mol |
| Exact Mass | 589.37 |
| IUPAC Name | — |
| SMILES | [B]N1C[C@H](N(C(=O)c2ccc(OC)c(OCCCOC)c2)C(C)C)CC[C@@H]1CCN(C(=O)Cc1cccc(C)c1)C1CC1 |
| InChI | InChI=1S/C34H48BN3O5/c1-24(2)38(34(40)27-10-15-31(42-5)32(22-27)43-19-7-18-41-4)30-14-13-29(37(35)23-30)16-17-36(28-11-12-28)33(39)21-26-9-6-8-25(3)20-26/h6,8-10,15,20,22,24,28-30H,7,11-14,16-19,21,23H2,1-5H3/t29-,30-/m1/s1 |
| InChIKey | HZKSLCMELQLRPD-LOYHVIPDSA-N |
| XLogP | 4.81 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|