About CID 89092998
CID 89092998 (PubChem CID 89092998) has the molecular formula C34H48BN3O5
and a molecular weight of 589.59 g/mol.
Molecular Properties
| Compound Name | CID 89092998 |
| PubChem CID | 89092998 |
| Molecular Formula | C34H48BN3O5 |
| Molecular Weight | 589.59 g/mol |
| Exact Mass | 589.37 |
| IUPAC Name | — |
| SMILES | [B]N1C[C@H](N(C(=O)c2ccc(OC)c(OCCCOC)c2)C(C)C)CC[C@@H]1CCN(C(=O)Cc1cccc(C)c1)C1CC1 |
| InChI | InChI=1S/C34H48BN3O5/c1-24(2)38(34(40)27-10-15-31(42-5)32(22-27)43-19-7-18-41-4)30-14-13-29(37(35)23-30)16-17-36(28-11-12-28)33(39)21-26-9-6-8-25(3)20-26/h6,8-10,15,20,22,24,28-30H,7,11-14,16-19,21,23H2,1-5H3/t29-,30-/m1/s1 |
| InChIKey | HZKSLCMELQLRPD-LOYHVIPDSA-N |
| XLogP | 4.81 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 589.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89092998 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89092998?
The IUPAC name of CID 89092998 (CID 89092998) is not available.
What is the SMILES notation for CID 89092998?
The canonical SMILES for CID 89092998 is [B]N1C[C@H](N(C(=O)c2ccc(OC)c(OCCCOC)c2)C(C)C)CC[C@@H]1CCN(C(=O)Cc1cccc(C)c1)C1CC1.
What is the InChIKey of CID 89092998?
The InChIKey is HZKSLCMELQLRPD-LOYHVIPDSA-N. The full InChI is InChI=1S/C34H48BN3O5/c1-24(2)38(34(40)27-10-15-31(42-5)32(22-27)43-19-7-18-41-4)30-14-13-29(37(35)23-30)16-17-36(28-11-12-28)33(39)21-26-9-6-8-25(3)20-26/h6,8-10,15,20,22,24,28-30H,7,11-14,16-19,21,23H2,1-5H3/t29-,30-/m1/s1.
What are the key properties of CID 89092998?
CID 89092998 has a molecular weight of 589.59 g/mol, XLogP of 4.81, 15 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89092998 is sourced from PubChem (CID 89092998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).