C27H44BN3O5 — CID 89092989
CID 89092989 (PubChem CID 89092989) has the molecular formula C27H44BN3O5 and a molecular weight of 501.48 g/mol.
| Compound Name | CID 89092989 |
|---|---|
| PubChem CID | 89092989 |
| Molecular Formula | C27H44BN3O5 |
| Molecular Weight | 501.48 g/mol |
| Exact Mass | 501.34 |
| IUPAC Name | — |
| SMILES | [B]N1CC(N(C(=O)c2ccc(OC)c(OCCCOC)c2)C(C)C)CCC1CC(=O)N(CC)C(C)C |
| InChI | InChI=1S/C27H44BN3O5/c1-8-29(19(2)3)26(32)17-22-11-12-23(18-30(22)28)31(20(4)5)27(33)21-10-13-24(35-7)25(16-21)36-15-9-14-34-6/h10,13,16,19-20,22-23H,8-9,11-12,14-15,17-18H2,1-7H3 |
| InChIKey | NHKHFMOEZPUOBW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|