C27H24N2O5S2 — CID 89093072
methyl (2S)-2-[(5Z)-5-[[6-(2,3-dimethoxyphenyl)-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoate (PubChem CID 89093072) has the molecular formula C27H24N2O5S2 and a molecular weight of 520.63 g/mol. Its IUPAC name is methyl (2S)-2-[(5Z)-5-[[6-(2,3-dimethoxyphenyl)-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[(5Z)-5-[[6-(2,3-dimethoxyphenyl)-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 89093072 |
| Molecular Formula | C27H24N2O5S2 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | methyl (2S)-2-[(5Z)-5-[[6-(2,3-dimethoxyphenyl)-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)N1C(=O)/C(=C/c2ccc(-c3cccc(OC)c3OC)nc2)SC1=S |
| InChI | InChI=1S/C27H24N2O5S2/c1-32-22-11-7-10-19(24(22)33-2)20-13-12-18(16-28-20)15-23-25(30)29(27(35)36-23)21(26(31)34-3)14-17-8-5-4-6-9-17/h4-13,15-16,21H,14H2,1-3H3/b23-15-/t21-/m0/s1 |
| InChIKey | VUCBAICZHHLESJ-XUVWKZFSSA-N |
| XLogP | 4.75 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|