C25H34I2N4O2 — CID 89093667
N-[(4-aminocyclohexyl)methyl]-4-[4-[3,4-bis(iodomethoxy)phenyl]piperazin-1-yl]aniline (PubChem CID 89093667) has the molecular formula C25H34I2N4O2 and a molecular weight of 676.38 g/mol. Its IUPAC name is N-[(4-aminocyclohexyl)methyl]-4-[4-[3,4-bis(iodomethoxy)phenyl]piperazin-1-yl]aniline.
| Compound Name | N-[(4-aminocyclohexyl)methyl]-4-[4-[3,4-bis(iodomethoxy)phenyl]piperazin-1-yl]aniline |
|---|---|
| PubChem CID | 89093667 |
| Molecular Formula | C25H34I2N4O2 |
| Molecular Weight | 676.38 g/mol |
| Exact Mass | 676.08 |
| IUPAC Name | N-[(4-aminocyclohexyl)methyl]-4-[4-[3,4-bis(iodomethoxy)phenyl]piperazin-1-yl]aniline |
| SMILES | NC1CCC(CNc2ccc(N3CCN(c4ccc(OCI)c(OCI)c4)CC3)cc2)CC1 |
| InChI | InChI=1S/C25H34I2N4O2/c26-17-32-24-10-9-23(15-25(24)33-18-27)31-13-11-30(12-14-31)22-7-5-21(6-8-22)29-16-19-1-3-20(28)4-2-19/h5-10,15,19-20,29H,1-4,11-14,16-18,28H2 |
| InChIKey | GLQFPMODUMPVJU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 62.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.38 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|