C18H28O2 — CID 89096192
(6E,11E,13E,15E)-2-hydroxy-2-methylheptadeca-6,11,13,15-tetraen-5-one (PubChem CID 89096192) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is (6E,11E,13E,15E)-2-hydroxy-2-methylheptadeca-6,11,13,15-tetraen-5-one.
| Compound Name | (6E,11E,13E,15E)-2-hydroxy-2-methylheptadeca-6,11,13,15-tetraen-5-one |
|---|---|
| PubChem CID | 89096192 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (6E,11E,13E,15E)-2-hydroxy-2-methylheptadeca-6,11,13,15-tetraen-5-one |
| SMILES | C/C=C/C=C/C=C/CCC/C=C/C(=O)CCC(C)(C)O |
| InChI | InChI=1S/C18H28O2/c1-4-5-6-7-8-9-10-11-12-13-14-17(19)15-16-18(2,3)20/h4-9,13-14,20H,10-12,15-16H2,1-3H3/b5-4+,7-6+,9-8+,14-13+ |
| InChIKey | JQYFYLCFXHFWQR-FRUKVIPESA-N |
| XLogP | 4.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|