C28H24F3N5O2 — CID 89099581
N-[[[4-[7-(6-methoxy-3-pyridinyl)imidazo[1,2-a]pyridin-3-yl]phenyl]methylamino]methoxy]-3-(trifluoromethyl)aniline (PubChem CID 89099581) has the molecular formula C28H24F3N5O2 and a molecular weight of 519.53 g/mol. Its IUPAC name is N-[[[4-[7-(6-methoxy-3-pyridinyl)imidazo[1,2-a]pyridin-3-yl]phenyl]methylamino]methoxy]-3-(trifluoromethyl)aniline.
| Compound Name | N-[[[4-[7-(6-methoxy-3-pyridinyl)imidazo[1,2-a]pyridin-3-yl]phenyl]methylamino]methoxy]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 89099581 |
| Molecular Formula | C28H24F3N5O2 |
| Molecular Weight | 519.53 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | N-[[[4-[7-(6-methoxy-3-pyridinyl)imidazo[1,2-a]pyridin-3-yl]phenyl]methylamino]methoxy]-3-(trifluoromethyl)aniline |
| SMILES | COc1ccc(-c2ccn3c(-c4ccc(CNCONc5cccc(C(F)(F)F)c5)cc4)cnc3c2)cn1 |
| InChI | InChI=1S/C28H24F3N5O2/c1-37-27-10-9-22(16-34-27)21-11-12-36-25(17-33-26(36)13-21)20-7-5-19(6-8-20)15-32-18-38-35-24-4-2-3-23(14-24)28(29,30)31/h2-14,16-17,32,35H,15,18H2,1H3 |
| InChIKey | FQVQYLCPKWNQMO-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 72.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.53 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|