About 4-ethoxy-3-fluoroazepane
4-ethoxy-3-fluoroazepane (PubChem CID 89100815) has the molecular formula C8H16FNO
and a molecular weight of 161.22 g/mol. Its IUPAC name is 4-ethoxy-3-fluoroazepane.
Molecular Properties
| Compound Name | 4-ethoxy-3-fluoroazepane |
| PubChem CID | 89100815 |
| Molecular Formula | C8H16FNO |
| Molecular Weight | 161.22 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 4-ethoxy-3-fluoroazepane |
| SMILES | CCOC1CCCNCC1F |
| InChI | InChI=1S/C8H16FNO/c1-2-11-8-4-3-5-10-6-7(8)9/h7-8,10H,2-6H2,1H3 |
| InChIKey | MAFWUTGVUKZHRP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.22 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethoxy-3-fluoroazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-3-fluoroazepane?
The IUPAC name of 4-ethoxy-3-fluoroazepane (CID 89100815) is 4-ethoxy-3-fluoroazepane.
What is the SMILES notation for 4-ethoxy-3-fluoroazepane?
The canonical SMILES for 4-ethoxy-3-fluoroazepane is CCOC1CCCNCC1F.
What is the InChIKey of 4-ethoxy-3-fluoroazepane?
The InChIKey is MAFWUTGVUKZHRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16FNO/c1-2-11-8-4-3-5-10-6-7(8)9/h7-8,10H,2-6H2,1H3.
What are the key properties of 4-ethoxy-3-fluoroazepane?
4-ethoxy-3-fluoroazepane has a molecular weight of 161.22 g/mol, XLogP of 1.11, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-3-fluoroazepane is sourced from PubChem (CID 89100815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).