(2R)-2-amino-4-hydroxy-3-methylpentanoic acid

C6H13NO3 — CID 89103200

IUPAC(2R)-2-amino-4-hydroxy-3-methylpentanoic acid
SMILESCC(O)C(C)[C@@H](N)C(=O)O
InChIInChI=1S/C6H13NO3/c1-3(4(2)8)5(7)6(9)10/h3-5,8H,7H2,1-2H3,(H,9,10)/t3?,4?,5-/m1/s1
InChIKeyOSCCDBFHNMXNME-ZAGMFXPOSA-N
MW147.17 g/mol
LogP-0.58
Rot. Bonds3

About (2R)-2-amino-4-hydroxy-3-methylpentanoic acid

(2R)-2-amino-4-hydroxy-3-methylpentanoic acid (PubChem CID 89103200) has the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. Its IUPAC name is (2R)-2-amino-4-hydroxy-3-methylpentanoic acid.

Molecular Properties

Compound Name(2R)-2-amino-4-hydroxy-3-methylpentanoic acid
PubChem CID89103200
Molecular FormulaC6H13NO3
Molecular Weight147.17 g/mol
Exact Mass147.09
IUPAC Name(2R)-2-amino-4-hydroxy-3-methylpentanoic acid
SMILESCC(O)C(C)[C@@H](N)C(=O)O
InChIInChI=1S/C6H13NO3/c1-3(4(2)8)5(7)6(9)10/h3-5,8H,7H2,1-2H3,(H,9,10)/t3?,4?,5-/m1/s1
InChIKeyOSCCDBFHNMXNME-ZAGMFXPOSA-N
XLogP-0.58
TPSA83.55 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500147.17
LogP ≤ 5-0.58
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (2R)-2-amino-4-hydroxy-3-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2S,3S)-2-amino-4-hydroxy-3-methylpentanoic acid
CID 55283948
(2S,3R)-2-amino-3-hydroxybutanoic acid
CID 158974218
(2S,3S)-2-amino-3-hydroxybutanoic acid;hydrochloride
CID 122360052
2-amino-3-hydroxybutanoic acid;selane
CID 174980406
(2R,3R)-2-amino-3,4-dimethylpentanoic acid
CID 87919550
2-amino-3-hydroxybutanoic acid;urea
CID 174908114
potassium;sodium;2-amino-3-hydroxybutanoic acid;hydride
CID 175449231
2-amino-3-hydroxybutanoic acid;(2S)-2-amino-3-methylbutanoic acid
CID 146265314
CID 87185843
CID 87185843
(2S)-2,5-diamino-3,4-dimethyl-5-oxopentanoic acid
CID 54362580
(2R)-2-(15N)azanyl-3-methylbutanoic acid
CID 10558606
(2S,3R)-2-amino-3-deuterio-3-hydroxybutanoic acid
CID 10582778

Frequently Asked Questions

What is the IUPAC name of (2R)-2-amino-4-hydroxy-3-methylpentanoic acid?
The IUPAC name of (2R)-2-amino-4-hydroxy-3-methylpentanoic acid (CID 89103200) is (2R)-2-amino-4-hydroxy-3-methylpentanoic acid.
What is the SMILES notation for (2R)-2-amino-4-hydroxy-3-methylpentanoic acid?
The canonical SMILES for (2R)-2-amino-4-hydroxy-3-methylpentanoic acid is CC(O)C(C)[C@@H](N)C(=O)O.
What is the InChIKey of (2R)-2-amino-4-hydroxy-3-methylpentanoic acid?
The InChIKey is OSCCDBFHNMXNME-ZAGMFXPOSA-N. The full InChI is InChI=1S/C6H13NO3/c1-3(4(2)8)5(7)6(9)10/h3-5,8H,7H2,1-2H3,(H,9,10)/t3?,4?,5-/m1/s1.
What are the key properties of (2R)-2-amino-4-hydroxy-3-methylpentanoic acid?
(2R)-2-amino-4-hydroxy-3-methylpentanoic acid has a molecular weight of 147.17 g/mol, XLogP of -0.58, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-4-hydroxy-3-methylpentanoic acid is sourced from PubChem (CID 89103200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).