C7H14N2O3 — CID 54362580
(2S)-2,5-diamino-3,4-dimethyl-5-oxopentanoic acid (PubChem CID 54362580) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is (2S)-2,5-diamino-3,4-dimethyl-5-oxopentanoic acid.
| Compound Name | (2S)-2,5-diamino-3,4-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 54362580 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (2S)-2,5-diamino-3,4-dimethyl-5-oxopentanoic acid |
| SMILES | CC(C(N)=O)C(C)[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H14N2O3/c1-3(4(2)6(9)10)5(8)7(11)12/h3-5H,8H2,1-2H3,(H2,9,10)(H,11,12)/t3?,4?,5-/m0/s1 |
| InChIKey | UNNMCZGATOLESU-YCXLAJEKSA-N |
| XLogP | -0.84 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |