C20H29N3O2S — CID 89103966
4-[1-[4-(3-amino-3-sulfanylidenepropyl)phenyl]piperidin-4-yl]piperidine-1-carboxylic acid (PubChem CID 89103966) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is 4-[1-[4-(3-amino-3-sulfanylidenepropyl)phenyl]piperidin-4-yl]piperidine-1-carboxylic acid.
| Compound Name | 4-[1-[4-(3-amino-3-sulfanylidenepropyl)phenyl]piperidin-4-yl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 89103966 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 4-[1-[4-(3-amino-3-sulfanylidenepropyl)phenyl]piperidin-4-yl]piperidine-1-carboxylic acid |
| SMILES | NC(=S)CCc1ccc(N2CCC(C3CCN(C(=O)O)CC3)CC2)cc1 |
| InChI | InChI=1S/C20H29N3O2S/c21-19(26)6-3-15-1-4-18(5-2-15)22-11-7-16(8-12-22)17-9-13-23(14-10-17)20(24)25/h1-2,4-5,16-17H,3,6-14H2,(H2,21,26)(H,24,25) |
| InChIKey | WTPBWQKAIPOVMY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|