C16H17F2N3O3 — CID 89105356
[(3S,4S)-4-ethenylpiperidin-3-yl] 5-(difluoromethoxy)-1H-indazole-3-carboxylate (PubChem CID 89105356) has the molecular formula C16H17F2N3O3 and a molecular weight of 337.33 g/mol. Its IUPAC name is [(3S,4S)-4-ethenylpiperidin-3-yl] 5-(difluoromethoxy)-1H-indazole-3-carboxylate.
| Compound Name | [(3S,4S)-4-ethenylpiperidin-3-yl] 5-(difluoromethoxy)-1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 89105356 |
| Molecular Formula | C16H17F2N3O3 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | [(3S,4S)-4-ethenylpiperidin-3-yl] 5-(difluoromethoxy)-1H-indazole-3-carboxylate |
| SMILES | C=C[C@@H]1CCNC[C@H]1OC(=O)c1n[nH]c2ccc(OC(F)F)cc12 |
| InChI | InChI=1S/C16H17F2N3O3/c1-2-9-5-6-19-8-13(9)24-15(22)14-11-7-10(23-16(17)18)3-4-12(11)20-21-14/h2-4,7,9,13,16,19H,1,5-6,8H2,(H,20,21)/t9-,13-/m1/s1 |
| InChIKey | DPAJEFVYKIMNSL-NOZJJQNGSA-N |
| XLogP | 2.49 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|