C9H8I2O4 — CID 89109362
2,3-bis(iodomethoxy)benzoic acid (PubChem CID 89109362) has the molecular formula C9H8I2O4 and a molecular weight of 433.97 g/mol. Its IUPAC name is 2,3-bis(iodomethoxy)benzoic acid.
| Compound Name | 2,3-bis(iodomethoxy)benzoic acid |
|---|---|
| PubChem CID | 89109362 |
| Molecular Formula | C9H8I2O4 |
| Molecular Weight | 433.97 g/mol |
| Exact Mass | 433.85 |
| IUPAC Name | 2,3-bis(iodomethoxy)benzoic acid |
| SMILES | O=C(O)c1cccc(OCI)c1OCI |
| InChI | InChI=1S/C9H8I2O4/c10-4-14-7-3-1-2-6(9(12)13)8(7)15-5-11/h1-3H,4-5H2,(H,12,13) |
| InChIKey | DPFBVDNEEKYSLC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.97 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|