C15H16N2O5 — CID 89109369
2,3-dihydroxy-4-(methylperoxymethyl)-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 89109369) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is 2,3-dihydroxy-4-(methylperoxymethyl)-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | 2,3-dihydroxy-4-(methylperoxymethyl)-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 89109369 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2,3-dihydroxy-4-(methylperoxymethyl)-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | COOCc1ccc(C(=O)NCc2ccccn2)c(O)c1O |
| InChI | InChI=1S/C15H16N2O5/c1-21-22-9-10-5-6-12(14(19)13(10)18)15(20)17-8-11-4-2-3-7-16-11/h2-7,18-19H,8-9H2,1H3,(H,17,20) |
| InChIKey | QCHNSSMXHUMUCD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|