C12H25F2N — CID 89110128
N-tert-butyl-2,2-difluoro-5,5-dimethylhexan-1-amine (PubChem CID 89110128) has the molecular formula C12H25F2N and a molecular weight of 221.33 g/mol. Its IUPAC name is N-tert-butyl-2,2-difluoro-5,5-dimethylhexan-1-amine.
| Compound Name | N-tert-butyl-2,2-difluoro-5,5-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 89110128 |
| Molecular Formula | C12H25F2N |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.20 |
| IUPAC Name | N-tert-butyl-2,2-difluoro-5,5-dimethylhexan-1-amine |
| SMILES | CC(C)(C)CCC(F)(F)CNC(C)(C)C |
| InChI | InChI=1S/C12H25F2N/c1-10(2,3)7-8-12(13,14)9-15-11(4,5)6/h15H,7-9H2,1-6H3 |
| InChIKey | ZXIYBSYOBNCJPG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |