C18H20F2N2O3S2 — CID 8911034
3-(diethylsulfamoyl)-N-[2-(difluoromethylsulfanyl)phenyl]benzamide (PubChem CID 8911034) has the molecular formula C18H20F2N2O3S2 and a molecular weight of 414.50 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-N-[2-(difluoromethylsulfanyl)phenyl]benzamide.
| Compound Name | 3-(diethylsulfamoyl)-N-[2-(difluoromethylsulfanyl)phenyl]benzamide |
|---|---|
| PubChem CID | 8911034 |
| Molecular Formula | C18H20F2N2O3S2 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 3-(diethylsulfamoyl)-N-[2-(difluoromethylsulfanyl)phenyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)Nc2ccccc2SC(F)F)c1 |
| InChI | InChI=1S/C18H20F2N2O3S2/c1-3-22(4-2)27(24,25)14-9-7-8-13(12-14)17(23)21-15-10-5-6-11-16(15)26-18(19)20/h5-12,18H,3-4H2,1-2H3,(H,21,23) |
| InChIKey | XVDBBORWGULXGL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |