C16H18O5 — CID 89110409
(E)-2-ethoxycarbonyl-3-[4-(2-methylprop-2-enoxy)phenyl]prop-2-enoic acid (PubChem CID 89110409) has the molecular formula C16H18O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is (E)-2-ethoxycarbonyl-3-[4-(2-methylprop-2-enoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-ethoxycarbonyl-3-[4-(2-methylprop-2-enoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 89110409 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (E)-2-ethoxycarbonyl-3-[4-(2-methylprop-2-enoxy)phenyl]prop-2-enoic acid |
| SMILES | C=C(C)COc1ccc(/C=C(\C(=O)O)C(=O)OCC)cc1 |
| InChI | InChI=1S/C16H18O5/c1-4-20-16(19)14(15(17)18)9-12-5-7-13(8-6-12)21-10-11(2)3/h5-9H,2,4,10H2,1,3H3,(H,17,18)/b14-9+ |
| InChIKey | PASHRQGXRASQIP-NTEUORMPSA-N |
| XLogP | 2.67 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|