C24H21BrCl2N6O2 — CID 89111812
N-[2-[(benzylamino)carbamoyl]-4-chloro-6-methylphenyl]-3-bromo-1-(3-chloro-3,4-dihydropyridin-2-yl)pyrazole-5-carboxamide (PubChem CID 89111812) has the molecular formula C24H21BrCl2N6O2 and a molecular weight of 576.28 g/mol. Its IUPAC name is N-[2-[(benzylamino)carbamoyl]-4-chloro-6-methylphenyl]-3-bromo-1-(3-chloro-3,4-dihydropyridin-2-yl)pyrazole-5-carboxamide.
| Compound Name | N-[2-[(benzylamino)carbamoyl]-4-chloro-6-methylphenyl]-3-bromo-1-(3-chloro-3,4-dihydropyridin-2-yl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 89111812 |
| Molecular Formula | C24H21BrCl2N6O2 |
| Molecular Weight | 576.28 g/mol |
| Exact Mass | 574.03 |
| IUPAC Name | N-[2-[(benzylamino)carbamoyl]-4-chloro-6-methylphenyl]-3-bromo-1-(3-chloro-3,4-dihydropyridin-2-yl)pyrazole-5-carboxamide |
| SMILES | Cc1cc(Cl)cc(C(=O)NNCc2ccccc2)c1NC(=O)c1cc(Br)nn1C1=NC=CCC1Cl |
| InChI | InChI=1S/C24H21BrCl2N6O2/c1-14-10-16(26)11-17(23(34)31-29-13-15-6-3-2-4-7-15)21(14)30-24(35)19-12-20(25)32-33(19)22-18(27)8-5-9-28-22/h2-7,9-12,18,29H,8,13H2,1H3,(H,30,35)(H,31,34) |
| InChIKey | GNBHWPXYPAMSAV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.28 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|