C15H16BN3O3 — CID 89114397
CID 89114397 (PubChem CID 89114397) has the molecular formula C15H16BN3O3 and a molecular weight of 297.12 g/mol.
| Compound Name | CID 89114397 |
|---|---|
| PubChem CID | 89114397 |
| Molecular Formula | C15H16BN3O3 |
| Molecular Weight | 297.12 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(OC)c2c(C(=O)C(=O)N3CCNCC3)c[nH]c12 |
| InChI | InChI=1S/C15H16BN3O3/c1-22-11-3-2-10(16)13-12(11)9(8-18-13)14(20)15(21)19-6-4-17-5-7-19/h2-3,8,17-18H,4-7H2,1H3 |
| InChIKey | CCFTXAOUAANJBG-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.12 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|