C18H18N6O4 — CID 91011492
1-[4-methoxy-7-(6-oxo-1H-pyrazin-3-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-piperazin-1-ylethane-1,2-dione (PubChem CID 91011492) has the molecular formula C18H18N6O4 and a molecular weight of 382.38 g/mol. Its IUPAC name is 1-[4-methoxy-7-(6-oxo-1H-pyrazin-3-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-piperazin-1-ylethane-1,2-dione.
| Compound Name | 1-[4-methoxy-7-(6-oxo-1H-pyrazin-3-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-piperazin-1-ylethane-1,2-dione |
|---|---|
| PubChem CID | 91011492 |
| Molecular Formula | C18H18N6O4 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 1-[4-methoxy-7-(6-oxo-1H-pyrazin-3-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-piperazin-1-ylethane-1,2-dione |
| SMILES | COc1cnc(-c2c[nH]c(=O)cn2)c2[nH]cc(C(=O)C(=O)N3CCNCC3)c12 |
| InChI | InChI=1S/C18H18N6O4/c1-28-12-8-23-15(11-7-21-13(25)9-20-11)16-14(12)10(6-22-16)17(26)18(27)24-4-2-19-3-5-24/h6-9,19,22H,2-5H2,1H3,(H,21,25) |
| InChIKey | GWGZQJFUKKKCLO-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 133.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|