C18H25F3N4O4 — CID 89115023
tert-butyl N-[[1-[4-formyl-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]piperidin-4-yl]methyl]carbamate (PubChem CID 89115023) has the molecular formula C18H25F3N4O4 and a molecular weight of 418.42 g/mol. Its IUPAC name is tert-butyl N-[[1-[4-formyl-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]piperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[4-formyl-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]piperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 89115023 |
| Molecular Formula | C18H25F3N4O4 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | tert-butyl N-[[1-[4-formyl-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]piperidin-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCN(c2nc(C=O)cc(OCC(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C18H25F3N4O4/c1-17(2,3)29-16(27)22-9-12-4-6-25(7-5-12)15-23-13(10-26)8-14(24-15)28-11-18(19,20)21/h8,10,12H,4-7,9,11H2,1-3H3,(H,22,27) |
| InChIKey | YXRMJYMNUYEZKG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|