C18H15N5O4 — CID 89117515
(3Z,6Z)-3-[(4-nitrophenyl)methylidene]-6-[(4-prop-1-en-2-yl-1H-imidazol-5-yl)methylidene]piperazine-2,5-dione (PubChem CID 89117515) has the molecular formula C18H15N5O4 and a molecular weight of 365.35 g/mol. Its IUPAC name is (3Z,6Z)-3-[(4-nitrophenyl)methylidene]-6-[(4-prop-1-en-2-yl-1H-imidazol-5-yl)methylidene]piperazine-2,5-dione.
| Compound Name | (3Z,6Z)-3-[(4-nitrophenyl)methylidene]-6-[(4-prop-1-en-2-yl-1H-imidazol-5-yl)methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 89117515 |
| Molecular Formula | C18H15N5O4 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | (3Z,6Z)-3-[(4-nitrophenyl)methylidene]-6-[(4-prop-1-en-2-yl-1H-imidazol-5-yl)methylidene]piperazine-2,5-dione |
| SMILES | C=C(C)c1nc[nH]c1/C=c1\[nH]c(=O)/c(=C/c2ccc([N+](=O)[O-])cc2)[nH]c1=O |
| InChI | InChI=1S/C18H15N5O4/c1-10(2)16-13(19-9-20-16)8-15-18(25)21-14(17(24)22-15)7-11-3-5-12(6-4-11)23(26)27/h3-9H,1H2,2H3,(H,19,20)(H,21,25)(H,22,24)/b14-7-,15-8- |
| InChIKey | ONKQIIGJOGOJQG-UOUVAZQYSA-N |
| XLogP | 0.39 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|