C15H20FN3O3 — CID 89119380
4-[[2-amino-4-(cyclopropylmethylamino)-5-fluorobenzoyl]amino]butanoic acid (PubChem CID 89119380) has the molecular formula C15H20FN3O3 and a molecular weight of 309.34 g/mol. Its IUPAC name is 4-[[2-amino-4-(cyclopropylmethylamino)-5-fluorobenzoyl]amino]butanoic acid.
| Compound Name | 4-[[2-amino-4-(cyclopropylmethylamino)-5-fluorobenzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 89119380 |
| Molecular Formula | C15H20FN3O3 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 4-[[2-amino-4-(cyclopropylmethylamino)-5-fluorobenzoyl]amino]butanoic acid |
| SMILES | Nc1cc(NCC2CC2)c(F)cc1C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C15H20FN3O3/c16-11-6-10(15(22)18-5-1-2-14(20)21)12(17)7-13(11)19-8-9-3-4-9/h6-7,9,19H,1-5,8,17H2,(H,18,22)(H,20,21) |
| InChIKey | KBQXFBHSWLRTTE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|