C22H32FN3O3 — CID 70940522
ethyl 4-[[2-(cyclopentylamino)-4-(cyclopropylmethylamino)-5-fluorobenzoyl]amino]butanoate (PubChem CID 70940522) has the molecular formula C22H32FN3O3 and a molecular weight of 405.51 g/mol. Its IUPAC name is ethyl 4-[[2-(cyclopentylamino)-4-(cyclopropylmethylamino)-5-fluorobenzoyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-(cyclopentylamino)-4-(cyclopropylmethylamino)-5-fluorobenzoyl]amino]butanoate |
|---|---|
| PubChem CID | 70940522 |
| Molecular Formula | C22H32FN3O3 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | ethyl 4-[[2-(cyclopentylamino)-4-(cyclopropylmethylamino)-5-fluorobenzoyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)c1cc(F)c(NCC2CC2)cc1NC1CCCC1 |
| InChI | InChI=1S/C22H32FN3O3/c1-2-29-21(27)8-5-11-24-22(28)17-12-18(23)20(25-14-15-9-10-15)13-19(17)26-16-6-3-4-7-16/h12-13,15-16,25-26H,2-11,14H2,1H3,(H,24,28) |
| InChIKey | CGSLEXCKFRBXRD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|