C22H30FN3O3 — CID 89119398
2-[[[4-(cyclohexylamino)-2-(cyclopentylamino)-5-fluorobenzoyl]amino]methyl]prop-2-enoic acid (PubChem CID 89119398) has the molecular formula C22H30FN3O3 and a molecular weight of 403.50 g/mol. Its IUPAC name is 2-[[[4-(cyclohexylamino)-2-(cyclopentylamino)-5-fluorobenzoyl]amino]methyl]prop-2-enoic acid.
| Compound Name | 2-[[[4-(cyclohexylamino)-2-(cyclopentylamino)-5-fluorobenzoyl]amino]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 89119398 |
| Molecular Formula | C22H30FN3O3 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 2-[[[4-(cyclohexylamino)-2-(cyclopentylamino)-5-fluorobenzoyl]amino]methyl]prop-2-enoic acid |
| SMILES | C=C(CNC(=O)c1cc(F)c(NC2CCCCC2)cc1NC1CCCC1)C(=O)O |
| InChI | InChI=1S/C22H30FN3O3/c1-14(22(28)29)13-24-21(27)17-11-18(23)20(26-16-7-3-2-4-8-16)12-19(17)25-15-9-5-6-10-15/h11-12,15-16,25-26H,1-10,13H2,(H,24,27)(H,28,29) |
| InChIKey | FLBUKUJZGLAZQJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|