C24H36FN3O3 — CID 70940471
4-[[4-(cyclohexylamino)-2-(cyclopentylamino)-5-fluorobenzoyl]amino]-2-ethylbutanoic acid (PubChem CID 70940471) has the molecular formula C24H36FN3O3 and a molecular weight of 433.57 g/mol. Its IUPAC name is 4-[[4-(cyclohexylamino)-2-(cyclopentylamino)-5-fluorobenzoyl]amino]-2-ethylbutanoic acid.
| Compound Name | 4-[[4-(cyclohexylamino)-2-(cyclopentylamino)-5-fluorobenzoyl]amino]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 70940471 |
| Molecular Formula | C24H36FN3O3 |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | 4-[[4-(cyclohexylamino)-2-(cyclopentylamino)-5-fluorobenzoyl]amino]-2-ethylbutanoic acid |
| SMILES | CCC(CCNC(=O)c1cc(F)c(NC2CCCCC2)cc1NC1CCCC1)C(=O)O |
| InChI | InChI=1S/C24H36FN3O3/c1-2-16(24(30)31)12-13-26-23(29)19-14-20(25)22(28-18-8-4-3-5-9-18)15-21(19)27-17-10-6-7-11-17/h14-18,27-28H,2-13H2,1H3,(H,26,29)(H,30,31) |
| InChIKey | SWPPGRMWCZUULM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |