C29H31N5O4 — CID 89119428
N-[(E)-(3-methoxyphenyl)methylideneamino]-1-[4-[[(E)-(3-methoxyphenyl)methylideneamino]carbamoyl]phenyl]piperidine-4-carboxamide (PubChem CID 89119428) has the molecular formula C29H31N5O4 and a molecular weight of 513.60 g/mol. Its IUPAC name is N-[(E)-(3-methoxyphenyl)methylideneamino]-1-[4-[[(E)-(3-methoxyphenyl)methylideneamino]carbamoyl]phenyl]piperidine-4-carboxamide.
| Compound Name | N-[(E)-(3-methoxyphenyl)methylideneamino]-1-[4-[[(E)-(3-methoxyphenyl)methylideneamino]carbamoyl]phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 89119428 |
| Molecular Formula | C29H31N5O4 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | N-[(E)-(3-methoxyphenyl)methylideneamino]-1-[4-[[(E)-(3-methoxyphenyl)methylideneamino]carbamoyl]phenyl]piperidine-4-carboxamide |
| SMILES | COc1cccc(/C=N/NC(=O)c2ccc(N3CCC(C(=O)N/N=C/c4cccc(OC)c4)CC3)cc2)c1 |
| InChI | InChI=1S/C29H31N5O4/c1-37-26-7-3-5-21(17-26)19-30-32-28(35)23-9-11-25(12-10-23)34-15-13-24(14-16-34)29(36)33-31-20-22-6-4-8-27(18-22)38-2/h3-12,17-20,24H,13-16H2,1-2H3,(H,32,35)(H,33,36)/b30-19+,31-20+ |
| InChIKey | RAKVHIVWKFWYSD-LVXWCJCWSA-N |
| XLogP | 3.83 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|