C23H25N3O3S — CID 89120885
N-[5-[(2,4-dimethoxyphenyl)methyl]-4-methyl-1,3-thiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide (PubChem CID 89120885) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is N-[5-[(2,4-dimethoxyphenyl)methyl]-4-methyl-1,3-thiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide.
| Compound Name | N-[5-[(2,4-dimethoxyphenyl)methyl]-4-methyl-1,3-thiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 89120885 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | N-[5-[(2,4-dimethoxyphenyl)methyl]-4-methyl-1,3-thiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide |
| SMILES | COc1ccc(Cc2sc(NC(=O)c3ccc4c(c3)CCNC4)nc2C)c(OC)c1 |
| InChI | InChI=1S/C23H25N3O3S/c1-14-21(11-16-6-7-19(28-2)12-20(16)29-3)30-23(25-14)26-22(27)17-4-5-18-13-24-9-8-15(18)10-17/h4-7,10,12,24H,8-9,11,13H2,1-3H3,(H,25,26,27) |
| InChIKey | VYFPJZGUKLPJGX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |