C30H47IO5 — CID 89122098
(4S,8R)-17-[(2R)-2,6-dihydroxy-3-iodo-6-methylheptan-2-yl]-2,6,6,18-tetramethyl-5,7-dioxapentacyclo[11.7.0.02,10.04,8.014,18]icos-12-en-11-one (PubChem CID 89122098) has the molecular formula C30H47IO5 and a molecular weight of 614.61 g/mol. Its IUPAC name is (4S,8R)-17-[(2R)-2,6-dihydroxy-3-iodo-6-methylheptan-2-yl]-2,6,6,18-tetramethyl-5,7-dioxapentacyclo[11.7.0.02,10.04,8.014,18]icos-12-en-11-one.
| Compound Name | (4S,8R)-17-[(2R)-2,6-dihydroxy-3-iodo-6-methylheptan-2-yl]-2,6,6,18-tetramethyl-5,7-dioxapentacyclo[11.7.0.02,10.04,8.014,18]icos-12-en-11-one |
|---|---|
| PubChem CID | 89122098 |
| Molecular Formula | C30H47IO5 |
| Molecular Weight | 614.61 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | (4S,8R)-17-[(2R)-2,6-dihydroxy-3-iodo-6-methylheptan-2-yl]-2,6,6,18-tetramethyl-5,7-dioxapentacyclo[11.7.0.02,10.04,8.014,18]icos-12-en-11-one |
| SMILES | CC(C)(O)CCC(I)[C@](C)(O)C1CCC2C3=CC(=O)C4C[C@H]5OC(C)(C)O[C@H]5CC4(C)C3CCC21C |
| InChI | InChI=1S/C30H47IO5/c1-26(2,33)12-11-25(31)30(7,34)24-9-8-18-17-14-21(32)20-15-22-23(36-27(3,4)35-22)16-29(20,6)19(17)10-13-28(18,24)5/h14,18-20,22-25,33-34H,8-13,15-16H2,1-7H3/t18?,19?,20?,22-,23+,24?,25?,28?,29?,30-/m1/s1 |
| InChIKey | URWRMBIFHRSNCP-OZUKMSMXSA-N |
| XLogP | 5.98 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.61 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|