C22H25N3O5 — CID 89122213
5-[cyclopropylidene-[[(1S)-2-hydroxy-1-phenylethyl]amino]methyl]-N-hydroxy-2,2-dimethyl-4H-[1,3]dioxino[4,5-c]pyridine-8-carboxamide (PubChem CID 89122213) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 5-[cyclopropylidene-[[(1S)-2-hydroxy-1-phenylethyl]amino]methyl]-N-hydroxy-2,2-dimethyl-4H-[1,3]dioxino[4,5-c]pyridine-8-carboxamide.
| Compound Name | 5-[cyclopropylidene-[[(1S)-2-hydroxy-1-phenylethyl]amino]methyl]-N-hydroxy-2,2-dimethyl-4H-[1,3]dioxino[4,5-c]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 89122213 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 5-[cyclopropylidene-[[(1S)-2-hydroxy-1-phenylethyl]amino]methyl]-N-hydroxy-2,2-dimethyl-4H-[1,3]dioxino[4,5-c]pyridine-8-carboxamide |
| SMILES | CC1(C)OCc2c(C(N[C@H](CO)c3ccccc3)=C3CC3)cnc(C(=O)NO)c2O1 |
| InChI | InChI=1S/C22H25N3O5/c1-22(2)29-12-16-15(10-23-19(20(16)30-22)21(27)25-28)18(14-8-9-14)24-17(11-26)13-6-4-3-5-7-13/h3-7,10,17,24,26,28H,8-9,11-12H2,1-2H3,(H,25,27)/t17-/m1/s1 |
| InChIKey | QBQUOIDOMVBCEP-QGZVFWFLSA-N |
| XLogP | 2.67 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|