C13H14N2S — CID 89122903
5-[(2Z,4Z)-hexa-2,4-dienyl]-1,3-dihydrobenzimidazole-2-thione (PubChem CID 89122903) has the molecular formula C13H14N2S and a molecular weight of 230.34 g/mol. Its IUPAC name is 5-[(2Z,4Z)-hexa-2,4-dienyl]-1,3-dihydrobenzimidazole-2-thione.
| Compound Name | 5-[(2Z,4Z)-hexa-2,4-dienyl]-1,3-dihydrobenzimidazole-2-thione |
|---|---|
| PubChem CID | 89122903 |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 5-[(2Z,4Z)-hexa-2,4-dienyl]-1,3-dihydrobenzimidazole-2-thione |
| SMILES | C/C=C\C=C/Cc1ccc2[nH]c(=S)[nH]c2c1 |
| InChI | InChI=1S/C13H14N2S/c1-2-3-4-5-6-10-7-8-11-12(9-10)15-13(16)14-11/h2-5,7-9H,6H2,1H3,(H2,14,15,16)/b3-2-,5-4- |
| InChIKey | MVUKHEPIRQSSNJ-LDIADDGTSA-N |
| XLogP | 3.90 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|