C26H37FN4O — CID 89126049
N-(cyclohexylmethyl)-2-[4-[2-(2-fluoroethylamino)ethyl]piperidin-1-yl]quinoline-4-carboxamide (PubChem CID 89126049) has the molecular formula C26H37FN4O and a molecular weight of 440.61 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-[4-[2-(2-fluoroethylamino)ethyl]piperidin-1-yl]quinoline-4-carboxamide.
| Compound Name | N-(cyclohexylmethyl)-2-[4-[2-(2-fluoroethylamino)ethyl]piperidin-1-yl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 89126049 |
| Molecular Formula | C26H37FN4O |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | N-(cyclohexylmethyl)-2-[4-[2-(2-fluoroethylamino)ethyl]piperidin-1-yl]quinoline-4-carboxamide |
| SMILES | O=C(NCC1CCCCC1)c1cc(N2CCC(CCNCCF)CC2)nc2ccccc12 |
| InChI | InChI=1S/C26H37FN4O/c27-13-15-28-14-10-20-11-16-31(17-12-20)25-18-23(22-8-4-5-9-24(22)30-25)26(32)29-19-21-6-2-1-3-7-21/h4-5,8-9,18,20-21,28H,1-3,6-7,10-17,19H2,(H,29,32) |
| InChIKey | MQUDWYQRRMOCCQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|