C22H24N4O5 — CID 89126748
[3-(3-hydroxypropyl)-2-[(3-nitrosobenzoyl)amino]benzimidazol-5-yl] 2,2-dimethylpropanoate (PubChem CID 89126748) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is [3-(3-hydroxypropyl)-2-[(3-nitrosobenzoyl)amino]benzimidazol-5-yl] 2,2-dimethylpropanoate.
| Compound Name | [3-(3-hydroxypropyl)-2-[(3-nitrosobenzoyl)amino]benzimidazol-5-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 89126748 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | [3-(3-hydroxypropyl)-2-[(3-nitrosobenzoyl)amino]benzimidazol-5-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc2nc(NC(=O)c3cccc(N=O)c3)n(CCCO)c2c1 |
| InChI | InChI=1S/C22H24N4O5/c1-22(2,3)20(29)31-16-8-9-17-18(13-16)26(10-5-11-27)21(23-17)24-19(28)14-6-4-7-15(12-14)25-30/h4,6-9,12-13,27H,5,10-11H2,1-3H3,(H,23,24,28) |
| InChIKey | KYUJUKFXMUGSMN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|