C24H31N5O4S — CID 89129414
[2-[(Z)-[2-(diazinan-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-4-(diethylcarbamoyl)phenyl] pyrrolidine-1-carboxylate (PubChem CID 89129414) has the molecular formula C24H31N5O4S and a molecular weight of 485.61 g/mol. Its IUPAC name is [2-[(Z)-[2-(diazinan-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-4-(diethylcarbamoyl)phenyl] pyrrolidine-1-carboxylate.
| Compound Name | [2-[(Z)-[2-(diazinan-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-4-(diethylcarbamoyl)phenyl] pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 89129414 |
| Molecular Formula | C24H31N5O4S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | [2-[(Z)-[2-(diazinan-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]-4-(diethylcarbamoyl)phenyl] pyrrolidine-1-carboxylate |
| SMILES | CCN(CC)C(=O)c1ccc(OC(=O)N2CCCC2)c(/C=C2\SC(N3CCCCN3)=NC2=O)c1 |
| InChI | InChI=1S/C24H31N5O4S/c1-3-27(4-2)22(31)17-9-10-19(33-24(32)28-12-7-8-13-28)18(15-17)16-20-21(30)26-23(34-20)29-14-6-5-11-25-29/h9-10,15-16,25H,3-8,11-14H2,1-2H3/b20-16- |
| InChIKey | RTKUXWRPKUMXCU-SILNSSARSA-N |
| XLogP | 3.33 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|