About 3-(5-methyl-4-tricyclo[4.1.0.01,3]hept-4-enyl)propanal
3-(5-methyl-4-tricyclo[4.1.0.01,3]hept-4-enyl)propanal (PubChem CID 89130619) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is 3-(5-methyl-4-tricyclo[4.1.0.01,3]hept-4-enyl)propanal.
Molecular Properties
| Compound Name | 3-(5-methyl-4-tricyclo[4.1.0.01,3]hept-4-enyl)propanal |
| PubChem CID | 89130619 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 3-(5-methyl-4-tricyclo[4.1.0.01,3]hept-4-enyl)propanal |
| SMILES | CC1=C(CCC=O)C2CC23CC13 |
| InChI | InChI=1S/C11H14O/c1-7-8(3-2-4-12)10-6-11(10)5-9(7)11/h4,9-10H,2-3,5-6H2,1H3 |
| InChIKey | ORRLWAIHMDQIMG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-methyl-4-tricyclo[4.1.0.01,3]hept-4-enyl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-methyl-4-tricyclo[4.1.0.01,3]hept-4-enyl)propanal?
The IUPAC name of 3-(5-methyl-4-tricyclo[4.1.0.01,3]hept-4-enyl)propanal (CID 89130619) is 3-(5-methyl-4-tricyclo[4.1.0.01,3]hept-4-enyl)propanal.
What is the SMILES notation for 3-(5-methyl-4-tricyclo[4.1.0.01,3]hept-4-enyl)propanal?
The canonical SMILES for 3-(5-methyl-4-tricyclo[4.1.0.01,3]hept-4-enyl)propanal is CC1=C(CCC=O)C2CC23CC13.
What is the InChIKey of 3-(5-methyl-4-tricyclo[4.1.0.01,3]hept-4-enyl)propanal?
The InChIKey is ORRLWAIHMDQIMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O/c1-7-8(3-2-4-12)10-6-11(10)5-9(7)11/h4,9-10H,2-3,5-6H2,1H3.
What are the key properties of 3-(5-methyl-4-tricyclo[4.1.0.01,3]hept-4-enyl)propanal?
3-(5-methyl-4-tricyclo[4.1.0.01,3]hept-4-enyl)propanal has a molecular weight of 162.23 g/mol, XLogP of 2.32, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methyl-4-tricyclo[4.1.0.01,3]hept-4-enyl)propanal is sourced from PubChem (CID 89130619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).