C20H16N2O2 — CID 89134715
4-(9,13-dimethyl-2-oxa-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-5-yl)benzaldehyde (PubChem CID 89134715) has the molecular formula C20H16N2O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is 4-(9,13-dimethyl-2-oxa-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-5-yl)benzaldehyde.
| Compound Name | 4-(9,13-dimethyl-2-oxa-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-5-yl)benzaldehyde |
|---|---|
| PubChem CID | 89134715 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 4-(9,13-dimethyl-2-oxa-4,14-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaen-5-yl)benzaldehyde |
| SMILES | Cc1ccc2c(n1)Oc1nc(-c3ccc(C=O)cc3)ccc1C2C |
| InChI | InChI=1S/C20H16N2O2/c1-12-3-8-16-13(2)17-9-10-18(22-20(17)24-19(16)21-12)15-6-4-14(11-23)5-7-15/h3-11,13H,1-2H3 |
| InChIKey | OJSYCHRLFHHHSM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|