C62H55NSi — CID 89139328
3-[3-(9,9-dimethylfluoren-2-yl)-10-(9,9-dimethylfluoren-3-yl)anthracen-9-yl]-5,9-dimethylspiro[8,9-dihydrobenzo[b][1,4]benzazasiline-10,1'-silolane] (PubChem CID 89139328) has the molecular formula C62H55NSi and a molecular weight of 842.22 g/mol. Its IUPAC name is 3-[3-(9,9-dimethylfluoren-2-yl)-10-(9,9-dimethylfluoren-3-yl)anthracen-9-yl]-5,9-dimethylspiro[8,9-dihydrobenzo[b][1,4]benzazasiline-10,1'-silolane].
| Compound Name | 3-[3-(9,9-dimethylfluoren-2-yl)-10-(9,9-dimethylfluoren-3-yl)anthracen-9-yl]-5,9-dimethylspiro[8,9-dihydrobenzo[b][1,4]benzazasiline-10,1'-silolane] |
|---|---|
| PubChem CID | 89139328 |
| Molecular Formula | C62H55NSi |
| Molecular Weight | 842.22 g/mol |
| Exact Mass | 841.41 |
| IUPAC Name | 3-[3-(9,9-dimethylfluoren-2-yl)-10-(9,9-dimethylfluoren-3-yl)anthracen-9-yl]-5,9-dimethylspiro[8,9-dihydrobenzo[b][1,4]benzazasiline-10,1'-silolane] |
| SMILES | CC1CC=CC2=C1[Si]1(CCCC1)c1ccc(-c3c4ccccc4c(-c4ccc5c(c4)-c4ccccc4C5(C)C)c4cc(-c5ccc6c(c5)C(C)(C)c5ccccc5-6)ccc34)cc1N2C |
| InChI | InChI=1S/C62H55NSi/c1-38-16-15-23-55-60(38)64(32-13-14-33-64)57-31-27-42(37-56(57)63(55)6)58-46-19-7-8-20-47(46)59(41-26-30-53-49(35-41)44-18-10-12-22-52(44)61(53,2)3)50-34-39(25-29-48(50)58)40-24-28-45-43-17-9-11-21-51(43)62(4,5)54(45)36-40/h7-12,15,17-31,34-38H,13-14,16,32-33H2,1-6H3 |
| InChIKey | GBNWBSGEJRDMFD-UHFFFAOYSA-N |
| XLogP | 15.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.22 |
| LogP ≤ 5 | 15.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|