C23H41N6O15P3S2 — CID 89140241
[[2-[[4-amino-5-[3-[3-[[2-amino-3-oxo-3-(pentylamino)propyl]disulfanyl]propanoylamino]prop-1-ynyl]-2-oxopyrimidin-1-yl]methoxy]-3-hydroxybutoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 89140241) has the molecular formula C23H41N6O15P3S2 and a molecular weight of 798.66 g/mol. Its IUPAC name is [[2-[[4-amino-5-[3-[3-[[2-amino-3-oxo-3-(pentylamino)propyl]disulfanyl]propanoylamino]prop-1-ynyl]-2-oxopyrimidin-1-yl]methoxy]-3-hydroxybutoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[2-[[4-amino-5-[3-[3-[[2-amino-3-oxo-3-(pentylamino)propyl]disulfanyl]propanoylamino]prop-1-ynyl]-2-oxopyrimidin-1-yl]methoxy]-3-hydroxybutoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 89140241 |
| Molecular Formula | C23H41N6O15P3S2 |
| Molecular Weight | 798.66 g/mol |
| Exact Mass | 798.13 |
| IUPAC Name | [[2-[[4-amino-5-[3-[3-[[2-amino-3-oxo-3-(pentylamino)propyl]disulfanyl]propanoylamino]prop-1-ynyl]-2-oxopyrimidin-1-yl]methoxy]-3-hydroxybutoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CCCCCNC(=O)C(N)CSSCCC(=O)NCC#Cc1cn(COC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(C)O)c(=O)nc1N |
| InChI | InChI=1S/C23H41N6O15P3S2/c1-3-4-5-9-27-22(32)18(24)14-49-48-11-8-20(31)26-10-6-7-17-12-29(23(33)28-21(17)25)15-41-19(16(2)30)13-42-46(37,38)44-47(39,40)43-45(34,35)36/h12,16,18-19,30H,3-5,8-11,13-15,24H2,1-2H3,(H,26,31)(H,27,32)(H,37,38)(H,39,40)(H2,25,28,33)(H2,34,35,36) |
| InChIKey | ORIZGWBYQQQZKG-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 334.41 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.66 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|