About (5-ethyl-2,5-dimethylhept-2-en-4-yl) dihydrogen phosphite
(5-ethyl-2,5-dimethylhept-2-en-4-yl) dihydrogen phosphite (PubChem CID 89140611) has the molecular formula C11H23O3P
and a molecular weight of 234.28 g/mol. Its IUPAC name is (5-ethyl-2,5-dimethylhept-2-en-4-yl) dihydrogen phosphite.
Molecular Properties
| Compound Name | (5-ethyl-2,5-dimethylhept-2-en-4-yl) dihydrogen phosphite |
| PubChem CID | 89140611 |
| Molecular Formula | C11H23O3P |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (5-ethyl-2,5-dimethylhept-2-en-4-yl) dihydrogen phosphite |
| SMILES | CCC(C)(CC)C(C=C(C)C)OP(O)O |
| InChI | InChI=1S/C11H23O3P/c1-6-11(5,7-2)10(8-9(3)4)14-15(12)13/h8,10,12-13H,6-7H2,1-5H3 |
| InChIKey | PMPZERGNFCJMEE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (5-ethyl-2,5-dimethylhept-2-en-4-yl) dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethyl-2,5-dimethylhept-2-en-4-yl) dihydrogen phosphite?
The IUPAC name of (5-ethyl-2,5-dimethylhept-2-en-4-yl) dihydrogen phosphite (CID 89140611) is (5-ethyl-2,5-dimethylhept-2-en-4-yl) dihydrogen phosphite.
What is the SMILES notation for (5-ethyl-2,5-dimethylhept-2-en-4-yl) dihydrogen phosphite?
The canonical SMILES for (5-ethyl-2,5-dimethylhept-2-en-4-yl) dihydrogen phosphite is CCC(C)(CC)C(C=C(C)C)OP(O)O.
What is the InChIKey of (5-ethyl-2,5-dimethylhept-2-en-4-yl) dihydrogen phosphite?
The InChIKey is PMPZERGNFCJMEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23O3P/c1-6-11(5,7-2)10(8-9(3)4)14-15(12)13/h8,10,12-13H,6-7H2,1-5H3.
What are the key properties of (5-ethyl-2,5-dimethylhept-2-en-4-yl) dihydrogen phosphite?
(5-ethyl-2,5-dimethylhept-2-en-4-yl) dihydrogen phosphite has a molecular weight of 234.28 g/mol, XLogP of 3.38, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethyl-2,5-dimethylhept-2-en-4-yl) dihydrogen phosphite is sourced from PubChem (CID 89140611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).