C7H14NO3P — CID 89142336
(2S)-2-(2-phosphorosobutan-2-ylamino)propanoic acid (PubChem CID 89142336) has the molecular formula C7H14NO3P and a molecular weight of 191.17 g/mol. Its IUPAC name is (2S)-2-(2-phosphorosobutan-2-ylamino)propanoic acid.
| Compound Name | (2S)-2-(2-phosphorosobutan-2-ylamino)propanoic acid |
|---|---|
| PubChem CID | 89142336 |
| Molecular Formula | C7H14NO3P |
| Molecular Weight | 191.17 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | (2S)-2-(2-phosphorosobutan-2-ylamino)propanoic acid |
| SMILES | CCC(C)(N[C@@H](C)C(=O)O)P=O |
| InChI | InChI=1S/C7H14NO3P/c1-4-7(3,12-11)8-5(2)6(9)10/h5,8H,4H2,1-3H3,(H,9,10)/t5-,7?/m0/s1 |
| InChIKey | XQQUGQOVACKYJG-DSEUIKHZSA-N |
| XLogP | 1.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.17 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|