C40H62O10 — CID 89142847
methyl 3,4,5-tributoxy-2-(2,3,4-tributoxy-6-methoxycarbonylphenyl)benzoate (PubChem CID 89142847) has the molecular formula C40H62O10 and a molecular weight of 702.93 g/mol. Its IUPAC name is methyl 3,4,5-tributoxy-2-(2,3,4-tributoxy-6-methoxycarbonylphenyl)benzoate.
| Compound Name | methyl 3,4,5-tributoxy-2-(2,3,4-tributoxy-6-methoxycarbonylphenyl)benzoate |
|---|---|
| PubChem CID | 89142847 |
| Molecular Formula | C40H62O10 |
| Molecular Weight | 702.93 g/mol |
| Exact Mass | 702.43 |
| IUPAC Name | methyl 3,4,5-tributoxy-2-(2,3,4-tributoxy-6-methoxycarbonylphenyl)benzoate |
| SMILES | CCCCOc1cc(C(=O)OC)c(-c2c(C(=O)OC)cc(OCCCC)c(OCCCC)c2OCCCC)c(OCCCC)c1OCCCC |
| InChI | InChI=1S/C40H62O10/c1-9-15-21-45-31-27-29(39(41)43-7)33(37(49-25-19-13-5)35(31)47-23-17-11-3)34-30(40(42)44-8)28-32(46-22-16-10-2)36(48-24-18-12-4)38(34)50-26-20-14-6/h27-28H,9-26H2,1-8H3 |
| InChIKey | BVASTGWJHRIDFP-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.93 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|