C38H58O10 — CID 88855796
3,4,5-tributoxy-2-(2,3,4-tributoxy-6-carboxyphenyl)benzoic acid (PubChem CID 88855796) has the molecular formula C38H58O10 and a molecular weight of 674.87 g/mol. Its IUPAC name is 3,4,5-tributoxy-2-(2,3,4-tributoxy-6-carboxyphenyl)benzoic acid.
| Compound Name | 3,4,5-tributoxy-2-(2,3,4-tributoxy-6-carboxyphenyl)benzoic acid |
|---|---|
| PubChem CID | 88855796 |
| Molecular Formula | C38H58O10 |
| Molecular Weight | 674.87 g/mol |
| Exact Mass | 674.40 |
| IUPAC Name | 3,4,5-tributoxy-2-(2,3,4-tributoxy-6-carboxyphenyl)benzoic acid |
| SMILES | CCCCOc1cc(C(=O)O)c(-c2c(C(=O)O)cc(OCCCC)c(OCCCC)c2OCCCC)c(OCCCC)c1OCCCC |
| InChI | InChI=1S/C38H58O10/c1-7-13-19-43-29-25-27(37(39)40)31(35(47-23-17-11-5)33(29)45-21-15-9-3)32-28(38(41)42)26-30(44-20-14-8-2)34(46-22-16-10-4)36(32)48-24-18-12-6/h25-26H,7-24H2,1-6H3,(H,39,40)(H,41,42) |
| InChIKey | FOKFTPAKEQWDOM-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.87 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|