C17H16ClF3N8O6 — CID 89145543
carboxy hydrogen carbonate;5-[8-chloro-6-morpholin-4-yl-9-(2,2,2-trifluoroethyl)purin-2-yl]pyrimidin-2-amine (PubChem CID 89145543) has the molecular formula C17H16ClF3N8O6 and a molecular weight of 520.81 g/mol. Its IUPAC name is carboxy hydrogen carbonate;5-[8-chloro-6-morpholin-4-yl-9-(2,2,2-trifluoroethyl)purin-2-yl]pyrimidin-2-amine.
| Compound Name | carboxy hydrogen carbonate;5-[8-chloro-6-morpholin-4-yl-9-(2,2,2-trifluoroethyl)purin-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 89145543 |
| Molecular Formula | C17H16ClF3N8O6 |
| Molecular Weight | 520.81 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | carboxy hydrogen carbonate;5-[8-chloro-6-morpholin-4-yl-9-(2,2,2-trifluoroethyl)purin-2-yl]pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2nc(N3CCOCC3)c3nc(Cl)n(CC(F)(F)F)c3n2)cn1.O=C(O)OC(=O)O |
| InChI | InChI=1S/C15H14ClF3N8O.C2H2O5/c16-13-23-9-11(26-1-3-28-4-2-26)24-10(8-5-21-14(20)22-6-8)25-12(9)27(13)7-15(17,18)19;3-1(4)7-2(5)6/h5-6H,1-4,7H2,(H2,20,21,22);(H,3,4)(H,5,6) |
| InChIKey | LSMUZMPUKWJDQI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 191.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.81 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|