C22H31F3N10O4S — CID 87093559
5-[8-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-morpholin-4-yl-9-(2,2,2-trifluoroethyl)purin-2-yl]pyrimidin-2-amine;methanesulfonic acid (PubChem CID 87093559) has the molecular formula C22H31F3N10O4S and a molecular weight of 588.62 g/mol. Its IUPAC name is 5-[8-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-morpholin-4-yl-9-(2,2,2-trifluoroethyl)purin-2-yl]pyrimidin-2-amine;methanesulfonic acid.
| Compound Name | 5-[8-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-morpholin-4-yl-9-(2,2,2-trifluoroethyl)purin-2-yl]pyrimidin-2-amine;methanesulfonic acid |
|---|---|
| PubChem CID | 87093559 |
| Molecular Formula | C22H31F3N10O4S |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | 5-[8-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6-morpholin-4-yl-9-(2,2,2-trifluoroethyl)purin-2-yl]pyrimidin-2-amine;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.C[C@@H]1CN(c2nc3c(N4CCOCC4)nc(-c4cnc(N)nc4)nc3n2CC(F)(F)F)C[C@H](C)N1 |
| InChI | InChI=1S/C21H27F3N10O.CH4O3S/c1-12-9-33(10-13(2)28-12)20-29-15-17(32-3-5-35-6-4-32)30-16(14-7-26-19(25)27-8-14)31-18(15)34(20)11-21(22,23)24;1-5(2,3)4/h7-8,12-13,28H,3-6,9-11H2,1-2H3,(H2,25,26,27);1H3,(H,2,3,4)/t12-,13+; |
| InChIKey | KDXNFZGGXVTWTE-OEEJBDNKSA-N |
| XLogP | 0.95 |
| TPSA | 177.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|